Organic acids and derivatives
Filtered Search Results
Methyl methanesulfonate, 99%
CAS: 66-27-3 Molecular Formula: C2H6O3S Molecular Weight (g/mol): 110.127 MDL Number: MFCD00007557 InChI Key: MBABOKRGFJTBAE-UHFFFAOYSA-N Synonym: methyl mesylate,methanesulfonic acid methyl ester,methanesulfonic acid, methyl ester,methylmethane sulfonate,methylmethansulfonat,methyl methanesulphonate,as-dimethyl sulfite,as-dimethyl sulphite,methylmethanesulfonate,methyl methansulfonate PubChem CID: 4156 ChEBI: CHEBI:25255 IUPAC Name: methyl methanesulfonate SMILES: COS(=O)(=O)C
| PubChem CID | 4156 |
|---|---|
| CAS | 66-27-3 |
| Molecular Weight (g/mol) | 110.127 |
| ChEBI | CHEBI:25255 |
| MDL Number | MFCD00007557 |
| SMILES | COS(=O)(=O)C |
| Synonym | methyl mesylate,methanesulfonic acid methyl ester,methanesulfonic acid, methyl ester,methylmethane sulfonate,methylmethansulfonat,methyl methanesulphonate,as-dimethyl sulfite,as-dimethyl sulphite,methylmethanesulfonate,methyl methansulfonate |
| IUPAC Name | methyl methanesulfonate |
| InChI Key | MBABOKRGFJTBAE-UHFFFAOYSA-N |
| Molecular Formula | C2H6O3S |
2-(Dimethylamino)ethyl Methacrylate (stabilized with MEHQ) 98.5+%, TCI America™
CAS: 2867-47-2 Molecular Formula: C8H15NO2 Molecular Weight (g/mol): 157.213 MDL Number: MFCD00008589 InChI Key: JKNCOURZONDCGV-UHFFFAOYSA-N Synonym: 2-dimethylamino ethyl methacrylate,dimethylaminoethyl methacrylate,ageflex fm-1,dmaema,usaf rh-3,2-propenoic acid, 2-methyl-, 2-dimethylamino ethyl ester,2-n,n-dimethylamino ethyl methacrylate,n,n-dimethylaminoethyl methacrylate,2-dimethylaminoethyl methacrylate,n,n-dimethylethanolamine methacrylate PubChem CID: 17869 IUPAC Name: 2-(dimethylamino)ethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCN(C)C
| PubChem CID | 17869 |
|---|---|
| CAS | 2867-47-2 |
| Molecular Weight (g/mol) | 157.213 |
| MDL Number | MFCD00008589 |
| SMILES | CC(=C)C(=O)OCCN(C)C |
| Synonym | 2-dimethylamino ethyl methacrylate,dimethylaminoethyl methacrylate,ageflex fm-1,dmaema,usaf rh-3,2-propenoic acid, 2-methyl-, 2-dimethylamino ethyl ester,2-n,n-dimethylamino ethyl methacrylate,n,n-dimethylaminoethyl methacrylate,2-dimethylaminoethyl methacrylate,n,n-dimethylethanolamine methacrylate |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate |
| InChI Key | JKNCOURZONDCGV-UHFFFAOYSA-N |
| Molecular Formula | C8H15NO2 |
tert-Butyl Acetate 99.0+%, TCI America™
CAS: 540-88-5 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008807 InChI Key: WMOVHXAZOJBABW-UHFFFAOYSA-N Synonym: t-butyl acetate,acetic acid tert-butyl ester,tert-butyl ethanoate,acetic acid, 1,1-dimethylethyl ester,texaco lead appreciator,acetic acid, tert-butyl ester,tert-butylacetate,tert butyl acetate,1,1-dimethylethyl acetate,1,1-dimethyl acetate PubChem CID: 10908 IUPAC Name: tert-butyl acetate SMILES: CC(=O)OC(C)(C)C
| PubChem CID | 10908 |
|---|---|
| CAS | 540-88-5 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00008807 |
| SMILES | CC(=O)OC(C)(C)C |
| Synonym | t-butyl acetate,acetic acid tert-butyl ester,tert-butyl ethanoate,acetic acid, 1,1-dimethylethyl ester,texaco lead appreciator,acetic acid, tert-butyl ester,tert-butylacetate,tert butyl acetate,1,1-dimethylethyl acetate,1,1-dimethyl acetate |
| IUPAC Name | tert-butyl acetate |
| InChI Key | WMOVHXAZOJBABW-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Trimethylacetic acid, 99%
CAS: 75-98-9 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.133 MDL Number: MFCD00004194 InChI Key: IUGYQRQAERSCNH-UHFFFAOYSA-N Synonym: pivalic acid,trimethylacetic acid,neopentanoic acid,2,2-dimethylpropionic acid,tert-pentanoic acid,propanoic acid, 2,2-dimethyl,versatic 5,kyselina pivalova,acetic acid, trimethyl,alpha,alpha-dimethylpropionic acid PubChem CID: 6417 ChEBI: CHEBI:45133 IUPAC Name: 2,2-dimethylpropanoic acid SMILES: CC(C)(C)C(=O)O
| PubChem CID | 6417 |
|---|---|
| CAS | 75-98-9 |
| Molecular Weight (g/mol) | 102.133 |
| ChEBI | CHEBI:45133 |
| MDL Number | MFCD00004194 |
| SMILES | CC(C)(C)C(=O)O |
| Synonym | pivalic acid,trimethylacetic acid,neopentanoic acid,2,2-dimethylpropionic acid,tert-pentanoic acid,propanoic acid, 2,2-dimethyl,versatic 5,kyselina pivalova,acetic acid, trimethyl,alpha,alpha-dimethylpropionic acid |
| IUPAC Name | 2,2-dimethylpropanoic acid |
| InChI Key | IUGYQRQAERSCNH-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
Sodium propionate, 99%
CAS: 137-40-6 Molecular Formula: C3H5NaO2 Molecular Weight (g/mol): 96.061 MDL Number: MFCD00002759 InChI Key: JXKPEJDQGNYQSM-UHFFFAOYSA-M Synonym: sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar PubChem CID: 2723816 IUPAC Name: sodium;propanoate SMILES: CCC(=O)[O-].[Na+]
| PubChem CID | 2723816 |
|---|---|
| CAS | 137-40-6 |
| Molecular Weight (g/mol) | 96.061 |
| MDL Number | MFCD00002759 |
| SMILES | CCC(=O)[O-].[Na+] |
| Synonym | sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar |
| IUPAC Name | sodium;propanoate |
| InChI Key | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Molecular Formula | C3H5NaO2 |
tert-Butyl acetate, 99%
CAS: 540-88-5 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008807 InChI Key: WMOVHXAZOJBABW-UHFFFAOYSA-N Synonym: t-butyl acetate,acetic acid tert-butyl ester,tert-butyl ethanoate,acetic acid, 1,1-dimethylethyl ester,texaco lead appreciator,acetic acid, tert-butyl ester,tert-butylacetate,tert butyl acetate,1,1-dimethylethyl acetate,1,1-dimethyl acetate PubChem CID: 10908 IUPAC Name: tert-butyl acetate SMILES: CC(=O)OC(C)(C)C
| PubChem CID | 10908 |
|---|---|
| CAS | 540-88-5 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00008807 |
| SMILES | CC(=O)OC(C)(C)C |
| Synonym | t-butyl acetate,acetic acid tert-butyl ester,tert-butyl ethanoate,acetic acid, 1,1-dimethylethyl ester,texaco lead appreciator,acetic acid, tert-butyl ester,tert-butylacetate,tert butyl acetate,1,1-dimethylethyl acetate,1,1-dimethyl acetate |
| IUPAC Name | tert-butyl acetate |
| InChI Key | WMOVHXAZOJBABW-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Samarium(III) trifluoromethanesulfonate, 98%
CAS: 52093-28-4 Molecular Formula: C3F9O9S3Sm Molecular Weight (g/mol): 597.55 MDL Number: MFCD00192431 InChI Key: DDCWGUIPLGMBPO-UHFFFAOYSA-K Synonym: samarium iii trifluoromethanesulfonate,samarium triflate,samarium iii triflate,samarium trifluoromethanesulfonate,trifluoromethanesulfonic acid samarium iii salt,samarium iii trifluoromethanesulfonate 97+%,sm otf 3,3cf3o3s.sm,samarium 3+ tritriflate PubChem CID: 10145316 IUPAC Name: samarium(3+);trifluoromethanesulfonate SMILES: [Sm+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F
| PubChem CID | 10145316 |
|---|---|
| CAS | 52093-28-4 |
| Molecular Weight (g/mol) | 597.55 |
| MDL Number | MFCD00192431 |
| SMILES | [Sm+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F |
| Synonym | samarium iii trifluoromethanesulfonate,samarium triflate,samarium iii triflate,samarium trifluoromethanesulfonate,trifluoromethanesulfonic acid samarium iii salt,samarium iii trifluoromethanesulfonate 97+%,sm otf 3,3cf3o3s.sm,samarium 3+ tritriflate |
| IUPAC Name | samarium(3+);trifluoromethanesulfonate |
| InChI Key | DDCWGUIPLGMBPO-UHFFFAOYSA-K |
| Molecular Formula | C3F9O9S3Sm |
5-Bromo-4-chloro-3-indolyl phosphate disodium salt, 98%
CAS: 102185-33-1 Molecular Formula: C8H4BrClNNa2O4P Molecular Weight (g/mol): 370.43 MDL Number: MFCD00036757 InChI Key: OAZUOCJOEUNDEK-UHFFFAOYSA-L PubChem CID: 6097197 IUPAC Name: disodium;(5-bromo-4-chloro-1H-indol-3-yl) phosphate SMILES: [Na+].[Na+].[O-]P([O-])(=O)OC1=CNC2=CC=C(Br)C(Cl)=C12
| PubChem CID | 6097197 |
|---|---|
| CAS | 102185-33-1 |
| Molecular Weight (g/mol) | 370.43 |
| MDL Number | MFCD00036757 |
| SMILES | [Na+].[Na+].[O-]P([O-])(=O)OC1=CNC2=CC=C(Br)C(Cl)=C12 |
| IUPAC Name | disodium;(5-bromo-4-chloro-1H-indol-3-yl) phosphate |
| InChI Key | OAZUOCJOEUNDEK-UHFFFAOYSA-L |
| Molecular Formula | C8H4BrClNNa2O4P |
Tri-o-tolyl phosphate, 96%
CAS: 78-30-8 Molecular Formula: C21H21O4P Molecular Weight (g/mol): 368.37 MDL Number: MFCD00041906 InChI Key: YSMRWXYRXBRSND-UHFFFAOYSA-N Synonym: tri-o-cresyl phosphate,tri-o-tolyl phosphate,o-tolyl phosphate,tocp,totp,phosphoric acid, tris 2-methylphenyl ester,o-cresyl phosphate,triorthocresyl phosphate,phosflex 179c,tri-2-tolyl phosphate PubChem CID: 6527 IUPAC Name: tris(2-methylphenyl) phosphate SMILES: CC1=CC=CC=C1OP(=O)(OC1=CC=CC=C1C)OC1=CC=CC=C1C
| PubChem CID | 6527 |
|---|---|
| CAS | 78-30-8 |
| Molecular Weight (g/mol) | 368.37 |
| MDL Number | MFCD00041906 |
| SMILES | CC1=CC=CC=C1OP(=O)(OC1=CC=CC=C1C)OC1=CC=CC=C1C |
| Synonym | tri-o-cresyl phosphate,tri-o-tolyl phosphate,o-tolyl phosphate,tocp,totp,phosphoric acid, tris 2-methylphenyl ester,o-cresyl phosphate,triorthocresyl phosphate,phosflex 179c,tri-2-tolyl phosphate |
| IUPAC Name | tris(2-methylphenyl) phosphate |
| InChI Key | YSMRWXYRXBRSND-UHFFFAOYSA-N |
| Molecular Formula | C21H21O4P |
Methyl Benzoate 99.0+%, TCI America™
CAS: 93-58-3 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00008421 InChI Key: QPJVMBTYPHYUOC-UHFFFAOYSA-N Synonym: methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le PubChem CID: 7150 ChEBI: CHEBI:72775 IUPAC Name: methyl benzoate SMILES: COC(=O)C1=CC=CC=C1
| PubChem CID | 7150 |
|---|---|
| CAS | 93-58-3 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:72775 |
| MDL Number | MFCD00008421 |
| SMILES | COC(=O)C1=CC=CC=C1 |
| Synonym | methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le |
| IUPAC Name | methyl benzoate |
| InChI Key | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
N-Hydroxyphthalimide 99.0+%, TCI America™
CAS: 524-38-9 Molecular Formula: C8H5NO3 Molecular Weight (g/mol): 163.13 MDL Number: MFCD00005891 InChI Key: CFMZSMGAMPBRBE-UHFFFAOYSA-N Synonym: n-hydroxyphthalimide,2-hydroxyisoindoline-1,3-dione,2-hydroxy-1h-isoindole-1,3 2h-dione,nhpi,2-hydroxyphthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxy,phthalimide, n-hydroxy,phthaloxime,unii-bxi99m81x0,2-hydroxyisoindolin-1,3-dione PubChem CID: 10665 IUPAC Name: 2-hydroxy-2,3-dihydro-1H-isoindole-1,3-dione SMILES: ON1C(=O)C2=CC=CC=C2C1=O
| PubChem CID | 10665 |
|---|---|
| CAS | 524-38-9 |
| Molecular Weight (g/mol) | 163.13 |
| MDL Number | MFCD00005891 |
| SMILES | ON1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-hydroxyphthalimide,2-hydroxyisoindoline-1,3-dione,2-hydroxy-1h-isoindole-1,3 2h-dione,nhpi,2-hydroxyphthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxy,phthalimide, n-hydroxy,phthaloxime,unii-bxi99m81x0,2-hydroxyisoindolin-1,3-dione |
| IUPAC Name | 2-hydroxy-2,3-dihydro-1H-isoindole-1,3-dione |
| InChI Key | CFMZSMGAMPBRBE-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO3 |
4-Vinyl-1,3-dioxolan-2-one, 99%
CAS: 4427-96-7 Molecular Formula: C5H6O3 Molecular Weight (g/mol): 114.1 MDL Number: MFCD00143315 InChI Key: BJWMSGRKJIOCNR-UHFFFAOYSA-N Synonym: 4-vinyl-1,3-dioxolan-2-one,vinylethylene carbonate,4-vinyl-1,3-dioxolan-2-one, stabilized with hydroquinone,1,3-dioxolan-2-one, 4-ethenyl,acmc-1ajgp,vec;,ksc383e5n,2-oxo-4-vinyl-1,3-dioxolane,4-vinyl-1,3 dioxolan-2-one,4-vinyl-1,3-dioxaolane-2-one PubChem CID: 2735038 IUPAC Name: 4-ethenyl-1,3-dioxolan-2-one SMILES: C=CC1COC(=O)O1
| PubChem CID | 2735038 |
|---|---|
| CAS | 4427-96-7 |
| Molecular Weight (g/mol) | 114.1 |
| MDL Number | MFCD00143315 |
| SMILES | C=CC1COC(=O)O1 |
| Synonym | 4-vinyl-1,3-dioxolan-2-one,vinylethylene carbonate,4-vinyl-1,3-dioxolan-2-one, stabilized with hydroquinone,1,3-dioxolan-2-one, 4-ethenyl,acmc-1ajgp,vec;,ksc383e5n,2-oxo-4-vinyl-1,3-dioxolane,4-vinyl-1,3 dioxolan-2-one,4-vinyl-1,3-dioxaolane-2-one |
| IUPAC Name | 4-ethenyl-1,3-dioxolan-2-one |
| InChI Key | BJWMSGRKJIOCNR-UHFFFAOYSA-N |
| Molecular Formula | C5H6O3 |
Ethyl stearate, 97%
CAS: 111-61-5 Molecular Formula: C20H40O2 Molecular Weight (g/mol): 312.52 MDL Number: MFCD00009006 InChI Key: MVLVMROFTAUDAG-UHFFFAOYSA-N Synonym: ethyl stearate,stearic acid ethyl ester,octadecanoic acid, ethyl ester,ethyl n-octadecanoate,stearic acid, ethyl ester,dicyclohexylammonium sulfate,unii-c64rtc734w,fema no. 3490,ethyl-stearate,ethyloctadecanoate PubChem CID: 8122 ChEBI: CHEBI:84936 IUPAC Name: ethyl octadecanoate SMILES: CCCCCCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 8122 |
|---|---|
| CAS | 111-61-5 |
| Molecular Weight (g/mol) | 312.52 |
| ChEBI | CHEBI:84936 |
| MDL Number | MFCD00009006 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl stearate,stearic acid ethyl ester,octadecanoic acid, ethyl ester,ethyl n-octadecanoate,stearic acid, ethyl ester,dicyclohexylammonium sulfate,unii-c64rtc734w,fema no. 3490,ethyl-stearate,ethyloctadecanoate |
| IUPAC Name | ethyl octadecanoate |
| InChI Key | MVLVMROFTAUDAG-UHFFFAOYSA-N |
| Molecular Formula | C20H40O2 |
Ethyl palmitate, 97%
CAS: 628-97-7 Molecular Formula: C18H36O2 Molecular Weight (g/mol): 284.48 MDL Number: MFCD00008996 InChI Key: XIRNKXNNONJFQO-UHFFFAOYSA-N Synonym: ethyl palmitate,hexadecanoic acid, ethyl ester,palmitic acid ethyl ester,ethyl cetylate,palmitic acid, ethyl ester,ethylpalmitate,unii-ird3m534zm,hexadecanoic acid ethyl ester,ethyl n-hexadecanoate,ird3m534zm PubChem CID: 12366 ChEBI: CHEBI:84932 IUPAC Name: ethyl hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 12366 |
|---|---|
| CAS | 628-97-7 |
| Molecular Weight (g/mol) | 284.48 |
| ChEBI | CHEBI:84932 |
| MDL Number | MFCD00008996 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl palmitate,hexadecanoic acid, ethyl ester,palmitic acid ethyl ester,ethyl cetylate,palmitic acid, ethyl ester,ethylpalmitate,unii-ird3m534zm,hexadecanoic acid ethyl ester,ethyl n-hexadecanoate,ird3m534zm |
| IUPAC Name | ethyl hexadecanoate |
| InChI Key | XIRNKXNNONJFQO-UHFFFAOYSA-N |
| Molecular Formula | C18H36O2 |
Ethyl myristate, 98+%
CAS: 124-06-1 Molecular Formula: C16H32O2 Molecular Weight (g/mol): 256.43 MDL Number: MFCD00008984 InChI Key: MMKRHZKQPFCLLS-UHFFFAOYSA-N Synonym: ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid PubChem CID: 31283 ChEBI: CHEBI:84849 IUPAC Name: ethyl tetradecanoate SMILES: CCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 31283 |
|---|---|
| CAS | 124-06-1 |
| Molecular Weight (g/mol) | 256.43 |
| ChEBI | CHEBI:84849 |
| MDL Number | MFCD00008984 |
| SMILES | CCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid |
| IUPAC Name | ethyl tetradecanoate |
| InChI Key | MMKRHZKQPFCLLS-UHFFFAOYSA-N |
| Molecular Formula | C16H32O2 |